C7H14Cl2O6P2 — CID 54148021
[dichloro-[cyclohexyloxy(hydroxy)phosphoryl]methyl]phosphonic acid (PubChem CID 54148021) has the molecular formula C7H14Cl2O6P2 and a molecular weight of 327.04 g/mol. Its IUPAC name is [dichloro-[cyclohexyloxy(hydroxy)phosphoryl]methyl]phosphonic acid.
| Compound Name | [dichloro-[cyclohexyloxy(hydroxy)phosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 54148021 |
| Molecular Formula | C7H14Cl2O6P2 |
| Molecular Weight | 327.04 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | [dichloro-[cyclohexyloxy(hydroxy)phosphoryl]methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Cl)(Cl)P(=O)(O)OC1CCCCC1 |
| InChI | InChI=1S/C7H14Cl2O6P2/c8-7(9,16(10,11)12)17(13,14)15-6-4-2-1-3-5-6/h6H,1-5H2,(H,13,14)(H2,10,11,12) |
| InChIKey | OFTCKXOSWBFJSM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.04 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|