C12H24O5P2S2 — CID 87475771
cyclohexyloxy-[cyclohexyloxy(hydroxy)phosphinothioyl]oxy-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 87475771) has the molecular formula C12H24O5P2S2 and a molecular weight of 374.40 g/mol. Its IUPAC name is cyclohexyloxy-[cyclohexyloxy(hydroxy)phosphinothioyl]oxy-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | cyclohexyloxy-[cyclohexyloxy(hydroxy)phosphinothioyl]oxy-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 87475771 |
| Molecular Formula | C12H24O5P2S2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | cyclohexyloxy-[cyclohexyloxy(hydroxy)phosphinothioyl]oxy-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | OP(=S)(OC1CCCCC1)OP(O)(=S)OC1CCCCC1 |
| InChI | InChI=1S/C12H24O5P2S2/c13-18(20,15-11-7-3-1-4-8-11)17-19(14,21)16-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,13,20)(H,14,21) |
| InChIKey | OWYBHXIIKFWZIL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|