C16H33O2PS2 — CID 21217479
cyclohexyloxy-decylsulfanyl-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 21217479) has the molecular formula C16H33O2PS2 and a molecular weight of 352.55 g/mol. Its IUPAC name is cyclohexyloxy-decylsulfanyl-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | cyclohexyloxy-decylsulfanyl-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 21217479 |
| Molecular Formula | C16H33O2PS2 |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | cyclohexyloxy-decylsulfanyl-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCCCCSP(O)(=S)OC1CCCCC1 |
| InChI | InChI=1S/C16H33O2PS2/c1-2-3-4-5-6-7-8-12-15-21-19(17,20)18-16-13-10-9-11-14-16/h16H,2-15H2,1H3,(H,17,20) |
| InChIKey | SCQYUJPVFVSBGQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|