About hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane
hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane (PubChem CID 173386502) has the molecular formula C10H25O2PPbS2
and a molecular weight of 479.62 g/mol. Its IUPAC name is hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane.
Molecular Properties
| Compound Name | hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane |
| PubChem CID | 173386502 |
| Molecular Formula | C10H25O2PPbS2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane |
| SMILES | CCCCCOP(O)(=S)SCCCCC.[PbH2] |
| InChI | InChI=1S/C10H23O2PS2.Pb.2H/c1-3-5-7-9-12-13(11,14)15-10-8-6-4-2;;;/h3-10H2,1-2H3,(H,11,14);;; |
| InChIKey | LLEDATCBXYJVQE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane?
The IUPAC name of hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane (CID 173386502) is hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane.
What is the SMILES notation for hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane?
The canonical SMILES for hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane is CCCCCOP(O)(=S)SCCCCC.[PbH2].
What is the InChIKey of hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane?
The InChIKey is LLEDATCBXYJVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O2PS2.Pb.2H/c1-3-5-7-9-12-13(11,14)15-10-8-6-4-2;;;/h3-10H2,1-2H3,(H,11,14);;;.
What are the key properties of hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane?
hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane has a molecular weight of 479.62 g/mol, XLogP of 3.42, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-pentoxy-pentylsulfanyl-sulfanylidene-λ5-phosphane;λ2-plumbane is sourced from PubChem (CID 173386502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).