About hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc
hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc (PubChem CID 87073286) has the molecular formula C18H39O2PS2Zn
and a molecular weight of 448.01 g/mol. Its IUPAC name is hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc.
Molecular Properties
| Compound Name | hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc |
| PubChem CID | 87073286 |
| Molecular Formula | C18H39O2PS2Zn |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc |
| SMILES | CCCCCCCCCOP(O)(=S)SCCCCCCCCC.[Zn] |
| InChI | InChI=1S/C18H39O2PS2.Zn/c1-3-5-7-9-11-13-15-17-20-21(19,22)23-18-16-14-12-10-8-6-4-2;/h3-18H2,1-2H3,(H,19,22); |
| InChIKey | WIFLLXVRPMLFMZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc?
The IUPAC name of hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc (CID 87073286) is hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc.
What is the SMILES notation for hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc?
The canonical SMILES for hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc is CCCCCCCCCOP(O)(=S)SCCCCCCCCC.[Zn].
What is the InChIKey of hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc?
The InChIKey is WIFLLXVRPMLFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39O2PS2.Zn/c1-3-5-7-9-11-13-15-17-20-21(19,22)23-18-16-14-12-10-8-6-4-2;/h3-18H2,1-2H3,(H,19,22);.
What are the key properties of hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc?
hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc has a molecular weight of 448.01 g/mol, XLogP of 7.45, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-nonoxy-nonylsulfanyl-sulfanylidene-λ5-phosphane;zinc is sourced from PubChem (CID 87073286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).