C14H30BiO2PS2 — CID 141192629
CID 141192629 (PubChem CID 141192629) has the molecular formula C14H30BiO2PS2 and a molecular weight of 534.48 g/mol.
| Compound Name | CID 141192629 |
|---|---|
| PubChem CID | 141192629 |
| Molecular Formula | C14H30BiO2PS2 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | — |
| SMILES | CCCCCCCOP(=S)(O[Bi])SCCCCCCC |
| InChI | InChI=1S/C14H31O2PS2.Bi/c1-3-5-7-9-11-13-16-17(15,18)19-14-12-10-8-6-4-2;/h3-14H2,1-2H3,(H,15,18);/q;+1/p-1 |
| InChIKey | SDZLNOYOBUWRDH-UHFFFAOYSA-M |
| XLogP | 6.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|