C36H70O2PPbS2 — CID 139924251
CID 139924251 (PubChem CID 139924251) has the molecular formula C36H70O2PPbS2 and a molecular weight of 837.26 g/mol.
| Compound Name | CID 139924251 |
|---|---|
| PubChem CID | 139924251 |
| Molecular Formula | C36H70O2PPbS2 |
| Molecular Weight | 837.26 g/mol |
| Exact Mass | 837.43 |
| IUPAC Name | — |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=S)(O[Pb])SCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C36H71O2PS2.Pb/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-39(37,40)41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20H,3-16,21-36H2,1-2H3,(H,37,40);/q;+1/p-1/b19-17-,20-18-; |
| InChIKey | WEHVEXMIWHENGI-AWLASTDMSA-M |
| XLogP | 14.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.26 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|