C2F5Na2O3P — CID 121334472
disodium;dioxido-oxo-(1,1,2,2,2-pentafluoroethyl)-λ5-phosphane (PubChem CID 121334472) has the molecular formula C2F5Na2O3P and a molecular weight of 243.96 g/mol. Its IUPAC name is disodium;dioxido-oxo-(1,1,2,2,2-pentafluoroethyl)-λ5-phosphane.
| Compound Name | disodium;dioxido-oxo-(1,1,2,2,2-pentafluoroethyl)-λ5-phosphane |
|---|---|
| PubChem CID | 121334472 |
| Molecular Formula | C2F5Na2O3P |
| Molecular Weight | 243.96 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | disodium;dioxido-oxo-(1,1,2,2,2-pentafluoroethyl)-λ5-phosphane |
| SMILES | O=P([O-])([O-])C(F)(F)C(F)(F)F.[Na+].[Na+] |
| InChI | InChI=1S/C2H2F5O3P.2Na/c3-1(4,5)2(6,7)11(8,9)10;;/h(H2,8,9,10);;/q;2*+1/p-2 |
| InChIKey | GVGRUPJAQJFTJR-UHFFFAOYSA-L |
| XLogP | -5.94 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.96 |
| LogP ≤ 5 | -5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|