CCl2Na2O6P2-2 — CID 23619782
disodium;[dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane (PubChem CID 23619782) has the molecular formula CCl2Na2O6P2-2 and a molecular weight of 286.84 g/mol. Its IUPAC name is disodium;[dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane.
| Compound Name | disodium;[dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 23619782 |
| Molecular Formula | CCl2Na2O6P2-2 |
| Molecular Weight | 286.84 g/mol |
| Exact Mass | 285.84 |
| IUPAC Name | disodium;[dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane |
| SMILES | O=P([O-])([O-])C(Cl)(Cl)P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/CH4Cl2O6P2.2Na/c2-1(3,10(4,5)6)11(7,8)9;;/h(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-4 |
| InChIKey | HJKBJIYDJLVSAO-UHFFFAOYSA-J |
| XLogP | -8.09 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.84 |
| LogP ≤ 5 | -8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|