C2H2Cl3O3P-2 — CID 19347926
dioxido-oxo-(1,1,2-trichloroethyl)-lambda5-phosphane (PubChem CID 19347926) has the molecular formula C2H2Cl3O3P-2 and a molecular weight of 211.37 g/mol. Its IUPAC name is dioxido-oxo-(1,1,2-trichloroethyl)-lambda5-phosphane.
| Compound Name | dioxido-oxo-(1,1,2-trichloroethyl)-lambda5-phosphane |
|---|---|
| PubChem CID | 19347926 |
| Molecular Formula | C2H2Cl3O3P-2 |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 209.88 |
| IUPAC Name | dioxido-oxo-(1,1,2-trichloroethyl)-lambda5-phosphane |
| SMILES | O=P([O-])([O-])C(Cl)(Cl)CCl |
| InChI | InChI=1S/C2H4Cl3O3P/c3-1-2(4,5)9(6,7)8/h1H2,(H2,6,7,8)/p-2 |
| InChIKey | GWBKZNXVVBRRHY-UHFFFAOYSA-L |
| XLogP | 0.27 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|