CCl2O6P2Pb2 — CID 88723359
[dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane;bis(lead(2+)) (PubChem CID 88723359) has the molecular formula CCl2O6P2Pb2 and a molecular weight of 655.26 g/mol. Its IUPAC name is [dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane;bis(lead(2+)).
| Compound Name | [dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane;bis(lead(2+)) |
|---|---|
| PubChem CID | 88723359 |
| Molecular Formula | CCl2O6P2Pb2 |
| Molecular Weight | 655.26 g/mol |
| Exact Mass | 655.81 |
| IUPAC Name | [dichloro(phosphonato)methyl]-dioxido-oxo-λ5-phosphane;bis(lead(2+)) |
| SMILES | O=P([O-])([O-])C(Cl)(Cl)P(=O)([O-])[O-].[Pb+2].[Pb+2] |
| InChI | InChI=1S/CH4Cl2O6P2.2Pb/c2-1(3,10(4,5)6)11(7,8)9;;/h(H2,4,5,6)(H2,7,8,9);;/q;2*+2/p-4 |
| InChIKey | OSLYQKQMBKWWMI-UHFFFAOYSA-J |
| XLogP | -2.86 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.26 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|