About azanium;sodium;phosphate
azanium;sodium;phosphate (PubChem CID 22506365) has the molecular formula H4NNaO4P-
and a molecular weight of 136.00 g/mol. Its IUPAC name is azanium;sodium;phosphate.
Molecular Properties
| Compound Name | azanium;sodium;phosphate |
| PubChem CID | 22506365 |
| Molecular Formula | H4NNaO4P- |
| Molecular Weight | 136.00 g/mol |
| Exact Mass | 135.98 |
| IUPAC Name | azanium;sodium;phosphate |
| SMILES | O=P([O-])([O-])[O-].[NH4+].[Na+] |
| InChI | InChI=1S/H3N.Na.H3O4P/c;;1-5(2,3)4/h1H3;;(H3,1,2,3,4)/q;+1;/p-2 |
| InChIKey | CUXQLKLUPGTTKL-UHFFFAOYSA-L |
| XLogP | -5.44 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.00 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azanium;sodium;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;sodium;phosphate?
The IUPAC name of azanium;sodium;phosphate (CID 22506365) is azanium;sodium;phosphate.
What is the SMILES notation for azanium;sodium;phosphate?
The canonical SMILES for azanium;sodium;phosphate is O=P([O-])([O-])[O-].[NH4+].[Na+].
What is the InChIKey of azanium;sodium;phosphate?
The InChIKey is CUXQLKLUPGTTKL-UHFFFAOYSA-L. The full InChI is InChI=1S/H3N.Na.H3O4P/c;;1-5(2,3)4/h1H3;;(H3,1,2,3,4)/q;+1;/p-2.
What are the key properties of azanium;sodium;phosphate?
azanium;sodium;phosphate has a molecular weight of 136.00 g/mol, XLogP of -5.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;sodium;phosphate is sourced from PubChem (CID 22506365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).