About sodium;tin(4+);phosphate
sodium;tin(4+);phosphate (PubChem CID 160930212) has the molecular formula NaO4PSn+2
and a molecular weight of 236.67 g/mol. Its IUPAC name is sodium;tin(4+);phosphate.
Molecular Properties
| Compound Name | sodium;tin(4+);phosphate |
| PubChem CID | 160930212 |
| Molecular Formula | NaO4PSn+2 |
| Molecular Weight | 236.67 g/mol |
| Exact Mass | 237.84 |
| IUPAC Name | sodium;tin(4+);phosphate |
| SMILES | O=P([O-])([O-])[O-].[Na+].[Sn+4] |
| InChI | InChI=1S/Na.H3O4P.Sn/c;1-5(2,3)4;/h;(H3,1,2,3,4);/q+1;;+4/p-3 |
| InChIKey | STDXRWFWVWTCMQ-UHFFFAOYSA-K |
| XLogP | -6.20 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.67 |
| LogP ≤ 5 | -6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;tin(4+);phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;tin(4+);phosphate?
The IUPAC name of sodium;tin(4+);phosphate (CID 160930212) is sodium;tin(4+);phosphate.
What is the SMILES notation for sodium;tin(4+);phosphate?
The canonical SMILES for sodium;tin(4+);phosphate is O=P([O-])([O-])[O-].[Na+].[Sn+4].
What is the InChIKey of sodium;tin(4+);phosphate?
The InChIKey is STDXRWFWVWTCMQ-UHFFFAOYSA-K. The full InChI is InChI=1S/Na.H3O4P.Sn/c;1-5(2,3)4;/h;(H3,1,2,3,4);/q+1;;+4/p-3.
What are the key properties of sodium;tin(4+);phosphate?
sodium;tin(4+);phosphate has a molecular weight of 236.67 g/mol, XLogP of -6.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;tin(4+);phosphate is sourced from PubChem (CID 160930212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).