C8H20N2O6P2-2 — CID 3455058
2-phosphonatopropan-2-yl-[2-(2-phosphonatopropan-2-ylazaniumyl)ethyl]azanium (PubChem CID 3455058) has the molecular formula C8H20N2O6P2-2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 2-phosphonatopropan-2-yl-[2-(2-phosphonatopropan-2-ylazaniumyl)ethyl]azanium.
| Compound Name | 2-phosphonatopropan-2-yl-[2-(2-phosphonatopropan-2-ylazaniumyl)ethyl]azanium |
|---|---|
| PubChem CID | 3455058 |
| Molecular Formula | C8H20N2O6P2-2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-phosphonatopropan-2-yl-[2-(2-phosphonatopropan-2-ylazaniumyl)ethyl]azanium |
| SMILES | CC(C)([NH2+]CC[NH2+]C(C)(C)P(=O)([O-])[O-])P(=O)([O-])[O-] |
| InChI | InChI=1S/C8H22N2O6P2/c1-7(2,17(11,12)13)9-5-6-10-8(3,4)18(14,15)16/h9-10H,5-6H2,1-4H3,(H2,11,12,13)(H2,14,15,16)/p-2 |
| InChIKey | OMDINQXXJNQASU-UHFFFAOYSA-L |
| XLogP | -4.59 |
| TPSA | 159.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|