About copper tert-butyl-dioxido-oxo-λ5-phosphane
copper tert-butyl-dioxido-oxo-λ5-phosphane (PubChem CID 155673850) has the molecular formula C4H9CuO3P
and a molecular weight of 199.63 g/mol. Its IUPAC name is copper tert-butyl-dioxido-oxo-λ5-phosphane.
Molecular Properties
| Compound Name | copper tert-butyl-dioxido-oxo-λ5-phosphane |
| PubChem CID | 155673850 |
| Molecular Formula | C4H9CuO3P |
| Molecular Weight | 199.63 g/mol |
| Exact Mass | 198.96 |
| IUPAC Name | copper tert-butyl-dioxido-oxo-λ5-phosphane |
| SMILES | CC(C)(C)P(=O)([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C4H11O3P.Cu/c1-4(2,3)8(5,6)7;/h1-3H3,(H2,5,6,7);/q;+2/p-2 |
| InChIKey | BFOABAXMIPODCR-UHFFFAOYSA-L |
| XLogP | -0.30 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.63 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper tert-butyl-dioxido-oxo-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper tert-butyl-dioxido-oxo-λ5-phosphane?
The IUPAC name of copper tert-butyl-dioxido-oxo-λ5-phosphane (CID 155673850) is copper tert-butyl-dioxido-oxo-λ5-phosphane.
What is the SMILES notation for copper tert-butyl-dioxido-oxo-λ5-phosphane?
The canonical SMILES for copper tert-butyl-dioxido-oxo-λ5-phosphane is CC(C)(C)P(=O)([O-])[O-].[Cu+2].
What is the InChIKey of copper tert-butyl-dioxido-oxo-λ5-phosphane?
The InChIKey is BFOABAXMIPODCR-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H11O3P.Cu/c1-4(2,3)8(5,6)7;/h1-3H3,(H2,5,6,7);/q;+2/p-2.
What are the key properties of copper tert-butyl-dioxido-oxo-λ5-phosphane?
copper tert-butyl-dioxido-oxo-λ5-phosphane has a molecular weight of 199.63 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper tert-butyl-dioxido-oxo-λ5-phosphane is sourced from PubChem (CID 155673850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).