About bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane
bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane (PubChem CID 175312218) has the molecular formula C17H39Al2O3P
and a molecular weight of 376.43 g/mol. Its IUPAC name is bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane.
Molecular Properties
| Compound Name | bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane |
| PubChem CID | 175312218 |
| Molecular Formula | C17H39Al2O3P |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane |
| SMILES | CC(C)(C)[Al+]C(C)(C)C.CC(C)(C)[Al+]C(C)(C)C.CP(=O)([O-])[O-] |
| InChI | InChI=1S/4C4H9.CH5O3P.2Al/c4*1-4(2)3;1-5(2,3)4;;/h4*1-3H3;1H3,(H2,2,3,4);;/q;;;;;2*+1/p-2 |
| InChIKey | GLRPMUASKSKXOK-UHFFFAOYSA-L |
| XLogP | 4.78 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane?
The IUPAC name of bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane (CID 175312218) is bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane.
What is the SMILES notation for bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane?
The canonical SMILES for bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane is CC(C)(C)[Al+]C(C)(C)C.CC(C)(C)[Al+]C(C)(C)C.CP(=O)([O-])[O-].
What is the InChIKey of bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane?
The InChIKey is GLRPMUASKSKXOK-UHFFFAOYSA-L. The full InChI is InChI=1S/4C4H9.CH5O3P.2Al/c4*1-4(2)3;1-5(2,3)4;;/h4*1-3H3;1H3,(H2,2,3,4);;/q;;;;;2*+1/p-2.
What are the key properties of bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane?
bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane has a molecular weight of 376.43 g/mol, XLogP of 4.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ditert-butylalumanylium);methyl-dioxido-oxo-λ5-phosphane is sourced from PubChem (CID 175312218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).