About diazanium;tert-butyl phosphate
diazanium;tert-butyl phosphate (PubChem CID 121268914) has the molecular formula C4H17N2O4P
and a molecular weight of 188.16 g/mol. Its IUPAC name is diazanium;tert-butyl phosphate.
Molecular Properties
| Compound Name | diazanium;tert-butyl phosphate |
| PubChem CID | 121268914 |
| Molecular Formula | C4H17N2O4P |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | diazanium;tert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H11O4P.2H3N/c1-4(2,3)8-9(5,6)7;;/h1-3H3,(H2,5,6,7);2*1H3 |
| InChIKey | LOOCVLCUQREXQQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diazanium;tert-butyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;tert-butyl phosphate?
The IUPAC name of diazanium;tert-butyl phosphate (CID 121268914) is diazanium;tert-butyl phosphate.
What is the SMILES notation for diazanium;tert-butyl phosphate?
The canonical SMILES for diazanium;tert-butyl phosphate is CC(C)(C)OP(=O)([O-])[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;tert-butyl phosphate?
The InChIKey is LOOCVLCUQREXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11O4P.2H3N/c1-4(2,3)8-9(5,6)7;;/h1-3H3,(H2,5,6,7);2*1H3.
What are the key properties of diazanium;tert-butyl phosphate?
diazanium;tert-butyl phosphate has a molecular weight of 188.16 g/mol, XLogP of 0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;tert-butyl phosphate is sourced from PubChem (CID 121268914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).