C10H23O6PS — CID 156782919
ditert-butyl methylsulfonylmethyl phosphate (PubChem CID 156782919) has the molecular formula C10H23O6PS and a molecular weight of 302.33 g/mol. Its IUPAC name is ditert-butyl methylsulfonylmethyl phosphate.
| Compound Name | ditert-butyl methylsulfonylmethyl phosphate |
|---|---|
| PubChem CID | 156782919 |
| Molecular Formula | C10H23O6PS |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | ditert-butyl methylsulfonylmethyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCS(C)(=O)=O)OC(C)(C)C |
| InChI | InChI=1S/C10H23O6PS/c1-9(2,3)15-17(11,16-10(4,5)6)14-8-18(7,12)13/h8H2,1-7H3 |
| InChIKey | WWUHWKMWXCMVFU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|