C13H29N2O6P — CID 168835594
bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl N-[2-(methylamino)ethyl]carbamate (PubChem CID 168835594) has the molecular formula C13H29N2O6P and a molecular weight of 340.36 g/mol. Its IUPAC name is bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl N-[2-(methylamino)ethyl]carbamate.
| Compound Name | bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl N-[2-(methylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 168835594 |
| Molecular Formula | C13H29N2O6P |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | bis[(2-methylpropan-2-yl)oxy]phosphoryloxymethyl N-[2-(methylamino)ethyl]carbamate |
| SMILES | CNCCNC(=O)OCOP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C13H29N2O6P/c1-12(2,3)20-22(17,21-13(4,5)6)19-10-18-11(16)15-9-8-14-7/h14H,8-10H2,1-7H3,(H,15,16) |
| InChIKey | VIKJUWWPJCFAMB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|