C7H15O6P — CID 159230701
[hydroxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxymethyl acetate (PubChem CID 159230701) has the molecular formula C7H15O6P and a molecular weight of 226.16 g/mol. Its IUPAC name is [hydroxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxymethyl acetate.
| Compound Name | [hydroxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxymethyl acetate |
|---|---|
| PubChem CID | 159230701 |
| Molecular Formula | C7H15O6P |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | [hydroxy-[(2-methylpropan-2-yl)oxy]phosphoryl]oxymethyl acetate |
| SMILES | CC(=O)OCOP(=O)(O)OC(C)(C)C |
| InChI | InChI=1S/C7H15O6P/c1-6(8)11-5-12-14(9,10)13-7(2,3)4/h5H2,1-4H3,(H,9,10) |
| InChIKey | FVHSYZJVQLQAQI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|