C11H23O6P — CID 156628851
[2,2-dimethylpropoxy(hydroxy)phosphoryl]oxymethyl 3-methylbutanoate (PubChem CID 156628851) has the molecular formula C11H23O6P and a molecular weight of 282.27 g/mol. Its IUPAC name is [2,2-dimethylpropoxy(hydroxy)phosphoryl]oxymethyl 3-methylbutanoate.
| Compound Name | [2,2-dimethylpropoxy(hydroxy)phosphoryl]oxymethyl 3-methylbutanoate |
|---|---|
| PubChem CID | 156628851 |
| Molecular Formula | C11H23O6P |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [2,2-dimethylpropoxy(hydroxy)phosphoryl]oxymethyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCOP(=O)(O)OCC(C)(C)C |
| InChI | InChI=1S/C11H23O6P/c1-9(2)6-10(12)15-8-17-18(13,14)16-7-11(3,4)5/h9H,6-8H2,1-5H3,(H,13,14) |
| InChIKey | XJCNJFUMLVNTIL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|