About [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid
[hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid (PubChem CID 23387641) has the molecular formula C8H15O8P
and a molecular weight of 270.17 g/mol. Its IUPAC name is [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid.
Molecular Properties
| Compound Name | [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid |
| PubChem CID | 23387641 |
| Molecular Formula | C8H15O8P |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid |
| SMILES | COCC(C)(C)C(=O)OCOP(=O)(O)C(=O)O |
| InChI | InChI=1S/C8H15O8P/c1-8(2,4-14-3)6(9)15-5-16-17(12,13)7(10)11/h4-5H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | GVOLRQCOKFMXFU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid?
The IUPAC name of [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid (CID 23387641) is [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid.
What is the SMILES notation for [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid?
The canonical SMILES for [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid is COCC(C)(C)C(=O)OCOP(=O)(O)C(=O)O.
What is the InChIKey of [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid?
The InChIKey is GVOLRQCOKFMXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O8P/c1-8(2,4-14-3)6(9)15-5-16-17(12,13)7(10)11/h4-5H2,1-3H3,(H,10,11)(H,12,13).
What are the key properties of [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid?
[hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid has a molecular weight of 270.17 g/mol, XLogP of 1.04, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid is sourced from PubChem (CID 23387641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).