C8H15O8P — CID 23387641
[hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid (PubChem CID 23387641) has the molecular formula C8H15O8P and a molecular weight of 270.17 g/mol. Its IUPAC name is [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid.
| Compound Name | [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid |
|---|---|
| PubChem CID | 23387641 |
| Molecular Formula | C8H15O8P |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | [hydroxy-[(3-methoxy-2,2-dimethylpropanoyl)oxymethoxy]phosphoryl]formic acid |
| SMILES | COCC(C)(C)C(=O)OCOP(=O)(O)C(=O)O |
| InChI | InChI=1S/C8H15O8P/c1-8(2,4-14-3)6(9)15-5-16-17(12,13)7(10)11/h4-5H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | GVOLRQCOKFMXFU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|