C9H19O5P — CID 88785162
(5-methoxy-2,4,4-trimethyl-3-oxopentan-2-yl)phosphonic acid (PubChem CID 88785162) has the molecular formula C9H19O5P and a molecular weight of 238.22 g/mol. Its IUPAC name is (5-methoxy-2,4,4-trimethyl-3-oxopentan-2-yl)phosphonic acid.
| Compound Name | (5-methoxy-2,4,4-trimethyl-3-oxopentan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 88785162 |
| Molecular Formula | C9H19O5P |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (5-methoxy-2,4,4-trimethyl-3-oxopentan-2-yl)phosphonic acid |
| SMILES | COCC(C)(C)C(=O)C(C)(C)P(=O)(O)O |
| InChI | InChI=1S/C9H19O5P/c1-8(2,6-14-5)7(10)9(3,4)15(11,12)13/h6H2,1-5H3,(H2,11,12,13) |
| InChIKey | FRTYARVOFAAXJQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|