C9H16O5 — CID 56990519
2-tert-butyl-2-(methoxymethyl)propanedioic acid (PubChem CID 56990519) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-tert-butyl-2-(methoxymethyl)propanedioic acid.
| Compound Name | 2-tert-butyl-2-(methoxymethyl)propanedioic acid |
|---|---|
| PubChem CID | 56990519 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-tert-butyl-2-(methoxymethyl)propanedioic acid |
| SMILES | COCC(C(=O)O)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H16O5/c1-8(2,3)9(5-14-4,6(10)11)7(12)13/h5H2,1-4H3,(H,10,11)(H,12,13) |
| InChIKey | CWSVCTUJCAEBJE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|