C8H14O8 — CID 22399558
2,3-dihydroxy-2,3-bis(methoxymethyl)butanedioic acid (PubChem CID 22399558) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(methoxymethyl)butanedioic acid.
| Compound Name | 2,3-dihydroxy-2,3-bis(methoxymethyl)butanedioic acid |
|---|---|
| PubChem CID | 22399558 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(methoxymethyl)butanedioic acid |
| SMILES | COCC(O)(C(=O)O)C(O)(COC)C(=O)O |
| InChI | InChI=1S/C8H14O8/c1-15-3-7(13,5(9)10)8(14,4-16-2)6(11)12/h13-14H,3-4H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | PSGKNGWFPBSERY-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |