2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid

C7H14O4 — CID 86184670

IUPAC2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid
SMILESCC(C)(C)C(O)(CO)C(=O)O
InChIInChI=1S/C7H14O4/c1-6(2,3)7(11,4-8)5(9)10/h8,11H,4H2,1-3H3,(H,9,10)
InChIKeyQLEJPVPJHWAGGU-UHFFFAOYSA-N
MW162.18 g/mol
LogP-0.16
Rot. Bonds2

About 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid

2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid (PubChem CID 86184670) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid
PubChem CID86184670
Molecular FormulaC7H14O4
Molecular Weight162.18 g/mol
Exact Mass162.09
IUPAC Name2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid
SMILESCC(C)(C)C(O)(CO)C(=O)O
InChIInChI=1S/C7H14O4/c1-6(2,3)7(11,4-8)5(9)10/h8,11H,4H2,1-3H3,(H,9,10)
InChIKeyQLEJPVPJHWAGGU-UHFFFAOYSA-N
XLogP-0.16
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.18
LogP ≤ 5-0.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid (CID 86184670) is 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid is CC(C)(C)C(O)(CO)C(=O)O.
What is the InChIKey of 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid?
The InChIKey is QLEJPVPJHWAGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-6(2,3)7(11,4-8)5(9)10/h8,11H,4H2,1-3H3,(H,9,10).
What are the key properties of 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid?
2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid has a molecular weight of 162.18 g/mol, XLogP of -0.16, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(hydroxymethyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 86184670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).