C14H20O11 — CID 139681284
(2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-6-oxoheptanoic acid (PubChem CID 139681284) has the molecular formula C14H20O11 and a molecular weight of 364.30 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-6-oxoheptanoic acid.
| Compound Name | (2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 139681284 |
| Molecular Formula | C14H20O11 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-6-oxoheptanoic acid |
| SMILES | CC(=O)[C@](O)(C(=O)O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@](O)(CO)C(C)=O |
| InChI | InChI=1S/C14H20O11/c1-6(16)11(22,5-15)13(24,8(3)18)14(25,9(4)19)12(23,7(2)17)10(20)21/h15,22-25H,5H2,1-4H3,(H,20,21)/t11-,12-,13+,14+/m0/s1 |
| InChIKey | SHHAGBBCZLIYAV-IGQOVBAYSA-N |
| XLogP | -3.66 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|