C13H19BrO9 — CID 175902701
(2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-5-methylhexanoyl bromide (PubChem CID 175902701) has the molecular formula C13H19BrO9 and a molecular weight of 399.19 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-5-methylhexanoyl bromide.
| Compound Name | (2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-5-methylhexanoyl bromide |
|---|---|
| PubChem CID | 175902701 |
| Molecular Formula | C13H19BrO9 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4-triacetyl-2,3,4,5,6-pentahydroxy-5-methylhexanoyl bromide |
| SMILES | CC(=O)[C@](O)(C(=O)Br)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@](C)(O)CO |
| InChI | InChI=1S/C13H19BrO9/c1-6(16)11(21,9(14)19)13(23,8(3)18)12(22,7(2)17)10(4,20)5-15/h15,20-23H,5H2,1-4H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | DTLRLJAPGUHSGK-YVECIDJPSA-N |
| XLogP | -2.39 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|