About (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one
(3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one (PubChem CID 97050329) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one.
Molecular Properties
| Compound Name | (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one |
| PubChem CID | 97050329 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one |
| SMILES | CC(=O)[C@@](C)(O)[C@](C)(O)N(C)C |
| InChI | InChI=1S/C8H17NO3/c1-6(10)7(2,11)8(3,12)9(4)5/h11-12H,1-5H3/t7-,8+/m1/s1 |
| InChIKey | VJYKJJWMDWPZKM-SFYZADRCSA-N |
| XLogP | -0.40 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one?
The IUPAC name of (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one (CID 97050329) is (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one.
What is the SMILES notation for (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one?
The canonical SMILES for (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one is CC(=O)[C@@](C)(O)[C@](C)(O)N(C)C.
What is the InChIKey of (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one?
The InChIKey is VJYKJJWMDWPZKM-SFYZADRCSA-N. The full InChI is InChI=1S/C8H17NO3/c1-6(10)7(2,11)8(3,12)9(4)5/h11-12H,1-5H3/t7-,8+/m1/s1.
What are the key properties of (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one?
(3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one has a molecular weight of 175.23 g/mol, XLogP of -0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-(dimethylamino)-3,4-dihydroxy-3-methylpentan-2-one is sourced from PubChem (CID 97050329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).