C8H14O4 — CID 538401
3,4-dihydroxy-3,4-dimethylhexane-2,5-dione (PubChem CID 538401) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione.
| Compound Name | 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione |
|---|---|
| PubChem CID | 538401 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione |
| SMILES | CC(=O)C(C)(O)C(C)(O)C(C)=O |
| InChI | InChI=1S/C8H14O4/c1-5(9)7(3,11)8(4,12)6(2)10/h11-12H,1-4H3 |
| InChIKey | MIMOQFCANZKFPQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |