About 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione
3,4-dihydroxy-3,4-dimethylhexane-2,5-dione (PubChem CID 538401) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione.
Molecular Properties
| Compound Name | 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione |
| PubChem CID | 538401 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione |
| SMILES | CC(=O)C(C)(O)C(C)(O)C(C)=O |
| InChI | InChI=1S/C8H14O4/c1-5(9)7(3,11)8(4,12)6(2)10/h11-12H,1-4H3 |
| InChIKey | MIMOQFCANZKFPQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione?
The IUPAC name of 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione (CID 538401) is 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione.
What is the SMILES notation for 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione?
The canonical SMILES for 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione is CC(=O)C(C)(O)C(C)(O)C(C)=O.
What is the InChIKey of 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione?
The InChIKey is MIMOQFCANZKFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-5(9)7(3,11)8(4,12)6(2)10/h11-12H,1-4H3.
What are the key properties of 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione?
3,4-dihydroxy-3,4-dimethylhexane-2,5-dione has a molecular weight of 174.20 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-3,4-dimethylhexane-2,5-dione is sourced from PubChem (CID 538401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).