C9H18O5 — CID 23565497
3,4,5,6-tetrahydroxy-3,4,5-trimethylhexan-2-one (PubChem CID 23565497) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-3,4,5-trimethylhexan-2-one.
| Compound Name | 3,4,5,6-tetrahydroxy-3,4,5-trimethylhexan-2-one |
|---|---|
| PubChem CID | 23565497 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-3,4,5-trimethylhexan-2-one |
| SMILES | CC(=O)C(C)(O)C(C)(O)C(C)(O)CO |
| InChI | InChI=1S/C9H18O5/c1-6(11)8(3,13)9(4,14)7(2,12)5-10/h10,12-14H,5H2,1-4H3 |
| InChIKey | ALPWBTYEQPCEMP-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |