C9H18O2 — CID 170290370
(3S)-3-(hydroxymethyl)-3,4,4-trimethylpentan-2-one (PubChem CID 170290370) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (3S)-3-(hydroxymethyl)-3,4,4-trimethylpentan-2-one.
| Compound Name | (3S)-3-(hydroxymethyl)-3,4,4-trimethylpentan-2-one |
|---|---|
| PubChem CID | 170290370 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (3S)-3-(hydroxymethyl)-3,4,4-trimethylpentan-2-one |
| SMILES | CC(=O)[C@](C)(CO)C(C)(C)C |
| InChI | InChI=1S/C9H18O2/c1-7(11)9(5,6-10)8(2,3)4/h10H,6H2,1-5H3/t9-/m0/s1 |
| InChIKey | CDTOCVHMJHHPDI-VIFPVBQESA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |