C14H19BrO9 — CID 141311165
(2S,3R,4S,5S)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-methyl-6-oxoheptanoyl bromide (PubChem CID 141311165) has the molecular formula C14H19BrO9 and a molecular weight of 411.20 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-methyl-6-oxoheptanoyl bromide.
| Compound Name | (2S,3R,4S,5S)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-methyl-6-oxoheptanoyl bromide |
|---|---|
| PubChem CID | 141311165 |
| Molecular Formula | C14H19BrO9 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | (2S,3R,4S,5S)-2,3,4-triacetyl-2,3,4,5-tetrahydroxy-5-methyl-6-oxoheptanoyl bromide |
| SMILES | CC(=O)[C@](O)(C(=O)Br)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](C)(O)C(C)=O |
| InChI | InChI=1S/C14H19BrO9/c1-6(16)11(5,21)13(23,8(3)18)14(24,9(4)19)12(22,7(2)17)10(15)20/h21-24H,1-5H3/t11-,12+,13+,14+/m1/s1 |
| InChIKey | MZBNPUSNKIECNT-RFGFWPKPSA-N |
| XLogP | -1.79 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|