C14H19N3O10 — CID 154305205
(4S,5S,6R)-4,5-diacetyl-6-[(1R)-1-azido-1,2-dihydroxyethyl]-4,5,6-trihydroxyoctane-2,3,7-trione (PubChem CID 154305205) has the molecular formula C14H19N3O10 and a molecular weight of 389.32 g/mol. Its IUPAC name is (4S,5S,6R)-4,5-diacetyl-6-[(1R)-1-azido-1,2-dihydroxyethyl]-4,5,6-trihydroxyoctane-2,3,7-trione.
| Compound Name | (4S,5S,6R)-4,5-diacetyl-6-[(1R)-1-azido-1,2-dihydroxyethyl]-4,5,6-trihydroxyoctane-2,3,7-trione |
|---|---|
| PubChem CID | 154305205 |
| Molecular Formula | C14H19N3O10 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (4S,5S,6R)-4,5-diacetyl-6-[(1R)-1-azido-1,2-dihydroxyethyl]-4,5,6-trihydroxyoctane-2,3,7-trione |
| SMILES | CC(=O)C(=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C14H19N3O10/c1-6(19)10(23)12(25,7(2)20)14(27,9(4)22)13(26,8(3)21)11(24,5-18)16-17-15/h18,24-27H,5H2,1-4H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | WQQYRLRGSVFTOB-ZOBORPQBSA-N |
| XLogP | -2.90 |
| TPSA | 235.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|