C6H11N3O4 — CID 175107112
1-azido-1-ethoxy-1,4-dihydroxybutan-2-one (PubChem CID 175107112) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is 1-azido-1-ethoxy-1,4-dihydroxybutan-2-one.
| Compound Name | 1-azido-1-ethoxy-1,4-dihydroxybutan-2-one |
|---|---|
| PubChem CID | 175107112 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 1-azido-1-ethoxy-1,4-dihydroxybutan-2-one |
| SMILES | CCOC(O)(N=[N+]=[N-])C(=O)CCO |
| InChI | InChI=1S/C6H11N3O4/c1-2-13-6(12,8-9-7)5(11)3-4-10/h10,12H,2-4H2,1H3 |
| InChIKey | CZLKASHYURYLMY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|