C7H12N6O — CID 18791928
2,4-diazido-2,4-dimethylpentan-3-one (PubChem CID 18791928) has the molecular formula C7H12N6O and a molecular weight of 196.21 g/mol. Its IUPAC name is 2,4-diazido-2,4-dimethylpentan-3-one.
| Compound Name | 2,4-diazido-2,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 18791928 |
| Molecular Formula | C7H12N6O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2,4-diazido-2,4-dimethylpentan-3-one |
| SMILES | CC(C)(N=[N+]=[N-])C(=O)C(C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C7H12N6O/c1-6(2,10-12-8)5(14)7(3,4)11-13-9/h1-4H3 |
| InChIKey | MBWICFBEDTZJKF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|