About bis(2-azidopropan-2-yl)diazene;dihydrochloride
bis(2-azidopropan-2-yl)diazene;dihydrochloride (PubChem CID 159195993) has the molecular formula C6H14Cl2N8
and a molecular weight of 269.14 g/mol. Its IUPAC name is bis(2-azidopropan-2-yl)diazene;dihydrochloride.
Molecular Properties
| Compound Name | bis(2-azidopropan-2-yl)diazene;dihydrochloride |
| PubChem CID | 159195993 |
| Molecular Formula | C6H14Cl2N8 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | bis(2-azidopropan-2-yl)diazene;dihydrochloride |
| SMILES | CC(C)(N=NC(C)(C)N=[N+]=[N-])N=[N+]=[N-].Cl.Cl |
| InChI | InChI=1S/C6H12N8.2ClH/c1-5(2,11-13-7)9-10-6(3,4)12-14-8;;/h1-4H3;2*1H |
| InChIKey | XLIGCKKZTGAQFN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 122.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze bis(2-azidopropan-2-yl)diazene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-azidopropan-2-yl)diazene;dihydrochloride?
The IUPAC name of bis(2-azidopropan-2-yl)diazene;dihydrochloride (CID 159195993) is bis(2-azidopropan-2-yl)diazene;dihydrochloride.
What is the SMILES notation for bis(2-azidopropan-2-yl)diazene;dihydrochloride?
The canonical SMILES for bis(2-azidopropan-2-yl)diazene;dihydrochloride is CC(C)(N=NC(C)(C)N=[N+]=[N-])N=[N+]=[N-].Cl.Cl.
What is the InChIKey of bis(2-azidopropan-2-yl)diazene;dihydrochloride?
The InChIKey is XLIGCKKZTGAQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N8.2ClH/c1-5(2,11-13-7)9-10-6(3,4)12-14-8;;/h1-4H3;2*1H.
What are the key properties of bis(2-azidopropan-2-yl)diazene;dihydrochloride?
bis(2-azidopropan-2-yl)diazene;dihydrochloride has a molecular weight of 269.14 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-azidopropan-2-yl)diazene;dihydrochloride is sourced from PubChem (CID 159195993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).