C8H14IN3O — CID 89181520
4-azido-2,2,4-trimethylpentanoyl iodide (PubChem CID 89181520) has the molecular formula C8H14IN3O and a molecular weight of 295.12 g/mol. Its IUPAC name is 4-azido-2,2,4-trimethylpentanoyl iodide.
| Compound Name | 4-azido-2,2,4-trimethylpentanoyl iodide |
|---|---|
| PubChem CID | 89181520 |
| Molecular Formula | C8H14IN3O |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-azido-2,2,4-trimethylpentanoyl iodide |
| SMILES | CC(C)(CC(C)(C)C(=O)I)N=[N+]=[N-] |
| InChI | InChI=1S/C8H14IN3O/c1-7(2,6(9)13)5-8(3,4)11-12-10/h5H2,1-4H3 |
| InChIKey | BLVWFOOSZFMNLO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|