C12H23N9 — CID 162371244
1,1,1-triazido-9,9-dimethyldecane (PubChem CID 162371244) has the molecular formula C12H23N9 and a molecular weight of 293.38 g/mol. Its IUPAC name is 1,1,1-triazido-9,9-dimethyldecane.
| Compound Name | 1,1,1-triazido-9,9-dimethyldecane |
|---|---|
| PubChem CID | 162371244 |
| Molecular Formula | C12H23N9 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1,1,1-triazido-9,9-dimethyldecane |
| SMILES | CC(C)(C)CCCCCCCC(N=[N+]=[N-])(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C12H23N9/c1-11(2,3)9-7-5-4-6-8-10-12(16-19-13,17-20-14)18-21-15/h4-10H2,1-3H3 |
| InChIKey | NXQFOJFPQWOXQI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 146.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|