About bis(5,5-dimethylhexyl)diazene
bis(5,5-dimethylhexyl)diazene (PubChem CID 18784258) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is bis(5,5-dimethylhexyl)diazene.
Molecular Properties
| Compound Name | bis(5,5-dimethylhexyl)diazene |
| PubChem CID | 18784258 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | bis(5,5-dimethylhexyl)diazene |
| SMILES | CC(C)(C)CCCC/N=N/CCCCC(C)(C)C |
| InChI | InChI=1S/C16H34N2/c1-15(2,3)11-7-9-13-17-18-14-10-8-12-16(4,5)6/h7-14H2,1-6H3/b18-17+ |
| InChIKey | VQJGDQSYRPFOJR-ISLYRVAYSA-N |
| XLogP | 5.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(5,5-dimethylhexyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5,5-dimethylhexyl)diazene?
The IUPAC name of bis(5,5-dimethylhexyl)diazene (CID 18784258) is bis(5,5-dimethylhexyl)diazene.
What is the SMILES notation for bis(5,5-dimethylhexyl)diazene?
The canonical SMILES for bis(5,5-dimethylhexyl)diazene is CC(C)(C)CCCC/N=N/CCCCC(C)(C)C.
What is the InChIKey of bis(5,5-dimethylhexyl)diazene?
The InChIKey is VQJGDQSYRPFOJR-ISLYRVAYSA-N. The full InChI is InChI=1S/C16H34N2/c1-15(2,3)11-7-9-13-17-18-14-10-8-12-16(4,5)6/h7-14H2,1-6H3/b18-17+.
What are the key properties of bis(5,5-dimethylhexyl)diazene?
bis(5,5-dimethylhexyl)diazene has a molecular weight of 254.46 g/mol, XLogP of 5.87, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5,5-dimethylhexyl)diazene is sourced from PubChem (CID 18784258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).