About ditert-butyldiazene;dihydrochloride
ditert-butyldiazene;dihydrochloride (PubChem CID 172805656) has the molecular formula C8H20Cl2N2
and a molecular weight of 215.17 g/mol. Its IUPAC name is ditert-butyldiazene;dihydrochloride.
Molecular Properties
| Compound Name | ditert-butyldiazene;dihydrochloride |
| PubChem CID | 172805656 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ditert-butyldiazene;dihydrochloride |
| SMILES | CC(C)(C)/N=N/C(C)(C)C.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-7(2,3)9-10-8(4,5)6;;/h1-6H3;2*1H/b10-9+;; |
| InChIKey | RLXHHERJQXDHME-TTWKNDKESA-N |
| XLogP | 3.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyldiazene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyldiazene;dihydrochloride?
The IUPAC name of ditert-butyldiazene;dihydrochloride (CID 172805656) is ditert-butyldiazene;dihydrochloride.
What is the SMILES notation for ditert-butyldiazene;dihydrochloride?
The canonical SMILES for ditert-butyldiazene;dihydrochloride is CC(C)(C)/N=N/C(C)(C)C.Cl.Cl.
What is the InChIKey of ditert-butyldiazene;dihydrochloride?
The InChIKey is RLXHHERJQXDHME-TTWKNDKESA-N. The full InChI is InChI=1S/C8H18N2.2ClH/c1-7(2,3)9-10-8(4,5)6;;/h1-6H3;2*1H/b10-9+;;.
What are the key properties of ditert-butyldiazene;dihydrochloride?
ditert-butyldiazene;dihydrochloride has a molecular weight of 215.17 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyldiazene;dihydrochloride is sourced from PubChem (CID 172805656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).