About bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+)
bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) (PubChem CID 155649796) has the molecular formula C16H36CoN6
and a molecular weight of 371.44 g/mol. Its IUPAC name is bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+).
Molecular Properties
| Compound Name | bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) |
| PubChem CID | 155649796 |
| Molecular Formula | C16H36CoN6 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) |
| SMILES | CC(C)(C)/N=N/[N-]C(C)(C)C.CC(C)(C)/N=N/[N-]C(C)(C)C.[Co+2] |
| InChI | InChI=1S/2C8H18N3.Co/c2*1-7(2,3)9-11-10-8(4,5)6;/h2*1-6H3;/q2*-1;+2 |
| InChIKey | HLWHNIMRMYIBQL-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 77.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+)?
The IUPAC name of bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) (CID 155649796) is bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+).
What is the SMILES notation for bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+)?
The canonical SMILES for bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) is CC(C)(C)/N=N/[N-]C(C)(C)C.CC(C)(C)/N=N/[N-]C(C)(C)C.[Co+2].
What is the InChIKey of bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+)?
The InChIKey is HLWHNIMRMYIBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H18N3.Co/c2*1-7(2,3)9-11-10-8(4,5)6;/h2*1-6H3;/q2*-1;+2.
What are the key properties of bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+)?
bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) has a molecular weight of 371.44 g/mol, XLogP of 6.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butyl-(tert-butyldiazenyl)azanide);cobalt(2+) is sourced from PubChem (CID 155649796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).