C21H48N2 — CID 162254065
ditert-butyldiazene;2,2-dimethylpropane;2,2,3,3-tetramethylbutane (PubChem CID 162254065) has the molecular formula C21H48N2 and a molecular weight of 328.63 g/mol. Its IUPAC name is ditert-butyldiazene;2,2-dimethylpropane;2,2,3,3-tetramethylbutane.
| Compound Name | ditert-butyldiazene;2,2-dimethylpropane;2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 162254065 |
| Molecular Formula | C21H48N2 |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 328.38 |
| IUPAC Name | ditert-butyldiazene;2,2-dimethylpropane;2,2,3,3-tetramethylbutane |
| SMILES | CC(C)(C)/N=N/C(C)(C)C.CC(C)(C)C.CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C8H18N2.C8H18.C5H12/c1-7(2,3)9-10-8(4,5)6;1-7(2,3)8(4,5)6;1-5(2,3)4/h1-6H3;1-6H3;1-4H3/b10-9+;; |
| InChIKey | ZYJDDXRQNFRFTG-TTWKNDKESA-N |
| XLogP | 8.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|