About azido(tert-butyl)silane
azido(tert-butyl)silane (PubChem CID 150332738) has the molecular formula C4H11N3Si
and a molecular weight of 129.24 g/mol. Its IUPAC name is azido(tert-butyl)silane.
Molecular Properties
| Compound Name | azido(tert-butyl)silane |
| PubChem CID | 150332738 |
| Molecular Formula | C4H11N3Si |
| Molecular Weight | 129.24 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | azido(tert-butyl)silane |
| SMILES | CC(C)(C)[SiH2]N=[N+]=[N-] |
| InChI | InChI=1S/C4H11N3Si/c1-4(2,3)8-7-6-5/h8H2,1-3H3 |
| InChIKey | GQAIEKUBMLTTQH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido(tert-butyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido(tert-butyl)silane?
The IUPAC name of azido(tert-butyl)silane (CID 150332738) is azido(tert-butyl)silane.
What is the SMILES notation for azido(tert-butyl)silane?
The canonical SMILES for azido(tert-butyl)silane is CC(C)(C)[SiH2]N=[N+]=[N-].
What is the InChIKey of azido(tert-butyl)silane?
The InChIKey is GQAIEKUBMLTTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3Si/c1-4(2,3)8-7-6-5/h8H2,1-3H3.
What are the key properties of azido(tert-butyl)silane?
azido(tert-butyl)silane has a molecular weight of 129.24 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azido(tert-butyl)silane is sourced from PubChem (CID 150332738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).