C16H22O10S — CID 175173616
(4S,5R,6R,7S)-4,5,6-triacetyl-4,5,6,8-tetrahydroxy-7-sulfanyldecane-2,3,9-trione (PubChem CID 175173616) has the molecular formula C16H22O10S and a molecular weight of 406.41 g/mol. Its IUPAC name is (4S,5R,6R,7S)-4,5,6-triacetyl-4,5,6,8-tetrahydroxy-7-sulfanyldecane-2,3,9-trione.
| Compound Name | (4S,5R,6R,7S)-4,5,6-triacetyl-4,5,6,8-tetrahydroxy-7-sulfanyldecane-2,3,9-trione |
|---|---|
| PubChem CID | 175173616 |
| Molecular Formula | C16H22O10S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (4S,5R,6R,7S)-4,5,6-triacetyl-4,5,6,8-tetrahydroxy-7-sulfanyldecane-2,3,9-trione |
| SMILES | CC(=O)C(=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@@H](S)C(O)C(C)=O |
| InChI | InChI=1S/C16H22O10S/c1-6(17)11(22)13(27)15(25,9(4)20)16(26,10(5)21)14(24,8(3)19)12(23)7(2)18/h11,13,22,24-27H,1-5H3/t11?,13-,14-,15+,16+/m0/s1 |
| InChIKey | JIYDGCBEQQKGSM-ACMYLQPLSA-N |
| XLogP | -2.65 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|