C12H18O9 — CID 174490725
3,4-diacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal (PubChem CID 174490725) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is 3,4-diacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal.
| Compound Name | 3,4-diacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal |
|---|---|
| PubChem CID | 174490725 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3,4-diacetyl-2,3,4,5,6-pentahydroxy-7-oxooctanal |
| SMILES | CC(=O)C(O)C(O)C(O)(C(C)=O)C(O)(C(C)=O)C(O)C=O |
| InChI | InChI=1S/C12H18O9/c1-5(14)9(18)10(19)12(21,7(3)16)11(20,6(2)15)8(17)4-13/h4,8-10,17-21H,1-3H3 |
| InChIKey | TWUFWPMMQHLJIN-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|