C7H15NO4 — CID 141485271
(2R,3R,4S,5S)-4-amino-2,3,5-trihydroxy-3-methylhexanal (PubChem CID 141485271) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2R,3R,4S,5S)-4-amino-2,3,5-trihydroxy-3-methylhexanal.
| Compound Name | (2R,3R,4S,5S)-4-amino-2,3,5-trihydroxy-3-methylhexanal |
|---|---|
| PubChem CID | 141485271 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (2R,3R,4S,5S)-4-amino-2,3,5-trihydroxy-3-methylhexanal |
| SMILES | C[C@H](O)[C@H](N)[C@@](C)(O)[C@@H](O)C=O |
| InChI | InChI=1S/C7H15NO4/c1-4(10)6(8)7(2,12)5(11)3-9/h3-6,10-12H,8H2,1-2H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | OZBWWBFZLKHUBH-AXMZGBSTSA-N |
| XLogP | -1.99 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|