About 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol
3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol (PubChem CID 87799633) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol.
Molecular Properties
| Compound Name | 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol |
| PubChem CID | 87799633 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol |
| SMILES | CC(O)C(C(C)(C)O)C(C)(C)O |
| InChI | InChI=1S/C9H20O3/c1-6(10)7(8(2,3)11)9(4,5)12/h6-7,10-12H,1-5H3 |
| InChIKey | NFBBKGZDHILAMJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol?
The IUPAC name of 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol (CID 87799633) is 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol.
What is the SMILES notation for 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol?
The canonical SMILES for 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol is CC(O)C(C(C)(C)O)C(C)(C)O.
What is the InChIKey of 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol?
The InChIKey is NFBBKGZDHILAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O3/c1-6(10)7(8(2,3)11)9(4,5)12/h6-7,10-12H,1-5H3.
What are the key properties of 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol?
3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol has a molecular weight of 176.26 g/mol, XLogP of 0.53, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxyethyl)-2,4-dimethylpentane-2,4-diol is sourced from PubChem (CID 87799633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).