About 3-tert-butyl-4,4-dimethylpentan-2-ol
3-tert-butyl-4,4-dimethylpentan-2-ol (PubChem CID 59805518) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is 3-tert-butyl-4,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-4,4-dimethylpentan-2-ol |
| PubChem CID | 59805518 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 3-tert-butyl-4,4-dimethylpentan-2-ol |
| SMILES | CC(O)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24O/c1-8(12)9(10(2,3)4)11(5,6)7/h8-9,12H,1-7H3 |
| InChIKey | GEWURCZCCQHYQU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-4,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4,4-dimethylpentan-2-ol?
The IUPAC name of 3-tert-butyl-4,4-dimethylpentan-2-ol (CID 59805518) is 3-tert-butyl-4,4-dimethylpentan-2-ol.
What is the SMILES notation for 3-tert-butyl-4,4-dimethylpentan-2-ol?
The canonical SMILES for 3-tert-butyl-4,4-dimethylpentan-2-ol is CC(O)C(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-tert-butyl-4,4-dimethylpentan-2-ol?
The InChIKey is GEWURCZCCQHYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O/c1-8(12)9(10(2,3)4)11(5,6)7/h8-9,12H,1-7H3.
What are the key properties of 3-tert-butyl-4,4-dimethylpentan-2-ol?
3-tert-butyl-4,4-dimethylpentan-2-ol has a molecular weight of 172.31 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4,4-dimethylpentan-2-ol is sourced from PubChem (CID 59805518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).