C11H16O8 — CID 174678786
5-acetyl-4,5,6,7-tetrahydroxynonane-2,3,8-trione (PubChem CID 174678786) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is 5-acetyl-4,5,6,7-tetrahydroxynonane-2,3,8-trione.
| Compound Name | 5-acetyl-4,5,6,7-tetrahydroxynonane-2,3,8-trione |
|---|---|
| PubChem CID | 174678786 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 5-acetyl-4,5,6,7-tetrahydroxynonane-2,3,8-trione |
| SMILES | CC(=O)C(=O)C(O)C(O)(C(C)=O)C(O)C(O)C(C)=O |
| InChI | InChI=1S/C11H16O8/c1-4(12)7(15)9(17)11(19,6(3)14)10(18)8(16)5(2)13/h7,9-10,15,17-19H,1-3H3 |
| InChIKey | YAEWIMYSBGTFFV-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|